C9H14N4 — CID 164922266
7-(cyanomethyl)-4-methyl-1,4-diazepane-1-carbonitrile (PubChem CID 164922266) has the molecular formula C9H14N4 and a molecular weight of 178.24 g/mol. Its IUPAC name is 7-(cyanomethyl)-4-methyl-1,4-diazepane-1-carbonitrile.
| Compound Name | 7-(cyanomethyl)-4-methyl-1,4-diazepane-1-carbonitrile |
|---|---|
| PubChem CID | 164922266 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 7-(cyanomethyl)-4-methyl-1,4-diazepane-1-carbonitrile |
| SMILES | CN1CCC(CC#N)N(C#N)CC1 |
| InChI | InChI=1S/C9H14N4/c1-12-5-3-9(2-4-10)13(8-11)7-6-12/h9H,2-3,5-7H2,1H3 |
| InChIKey | BUDNEEGEOHUIRF-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|