C9H16N4 — CID 84657592
3-(5-methyl-1H-1,2,4-triazol-3-yl)azepane (PubChem CID 84657592) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-(5-methyl-1H-1,2,4-triazol-3-yl)azepane.
| Compound Name | 3-(5-methyl-1H-1,2,4-triazol-3-yl)azepane |
|---|---|
| PubChem CID | 84657592 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 3-(5-methyl-1H-1,2,4-triazol-3-yl)azepane |
| SMILES | Cc1nc(C2CCCCNC2)n[nH]1 |
| InChI | InChI=1S/C9H16N4/c1-7-11-9(13-12-7)8-4-2-3-5-10-6-8/h8,10H,2-6H2,1H3,(H,11,12,13) |
| InChIKey | GBRKFYJCDADEMR-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |