About 1-methyl-2-piperidin-4-yl-5,6-dihydro-4H-pyrimidine
1-methyl-2-piperidin-4-yl-5,6-dihydro-4H-pyrimidine (PubChem CID 84658187) has the molecular formula C10H19N3
and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-methyl-2-piperidin-4-yl-5,6-dihydro-4H-pyrimidine.
Analyze 1-methyl-2-piperidin-4-yl-5,6-dihydro-4H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-piperidin-4-yl-5,6-dihydro-4H-pyrimidine?
The IUPAC name of 1-methyl-2-piperidin-4-yl-5,6-dihydro-4H-pyrimidine (CID 84658187) is 1-methyl-2-piperidin-4-yl-5,6-dihydro-4H-pyrimidine.
What is the SMILES notation for 1-methyl-2-piperidin-4-yl-5,6-dihydro-4H-pyrimidine?
The canonical SMILES for 1-methyl-2-piperidin-4-yl-5,6-dihydro-4H-pyrimidine is CN1CCCN=C1C1CCNCC1.
What is the InChIKey of 1-methyl-2-piperidin-4-yl-5,6-dihydro-4H-pyrimidine?
The InChIKey is SAJYFDQKWKVZPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3/c1-13-8-2-5-12-10(13)9-3-6-11-7-4-9/h9,11H,2-8H2,1H3.
What are the key properties of 1-methyl-2-piperidin-4-yl-5,6-dihydro-4H-pyrimidine?
1-methyl-2-piperidin-4-yl-5,6-dihydro-4H-pyrimidine has a molecular weight of 181.28 g/mol, XLogP of 0.72, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-piperidin-4-yl-5,6-dihydro-4H-pyrimidine is sourced from PubChem (CID 84658187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).