C9H9NO2S — CID 84666230
4-amino-2,3-dihydro-1-benzothiophene-6-carboxylic acid (PubChem CID 84666230) has the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. Its IUPAC name is 4-amino-2,3-dihydro-1-benzothiophene-6-carboxylic acid.
| Compound Name | 4-amino-2,3-dihydro-1-benzothiophene-6-carboxylic acid |
|---|---|
| PubChem CID | 84666230 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 4-amino-2,3-dihydro-1-benzothiophene-6-carboxylic acid |
| SMILES | Nc1cc(C(=O)O)cc2c1CCS2 |
| InChI | InChI=1S/C9H9NO2S/c10-7-3-5(9(11)12)4-8-6(7)1-2-13-8/h3-4H,1-2,10H2,(H,11,12) |
| InChIKey | LTTXJYARJNXBNR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|