About 3-(5-chloro-1H-1,2,4-triazol-3-yl)phenol
3-(5-chloro-1H-1,2,4-triazol-3-yl)phenol (PubChem CID 84666531) has the molecular formula C8H6ClN3O
and a molecular weight of 195.61 g/mol. Its IUPAC name is 3-(5-chloro-1H-1,2,4-triazol-3-yl)phenol.
Molecular Properties
| Compound Name | 3-(5-chloro-1H-1,2,4-triazol-3-yl)phenol |
| PubChem CID | 84666531 |
| Molecular Formula | C8H6ClN3O |
| Molecular Weight | 195.61 g/mol |
| Exact Mass | 195.02 |
| IUPAC Name | 3-(5-chloro-1H-1,2,4-triazol-3-yl)phenol |
| SMILES | Oc1cccc(-c2n[nH]c(Cl)n2)c1 |
| InChI | InChI=1S/C8H6ClN3O/c9-8-10-7(11-12-8)5-2-1-3-6(13)4-5/h1-4,13H,(H,10,11,12) |
| InChIKey | UOFHYCLSDJAYLN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.61 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(5-chloro-1H-1,2,4-triazol-3-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-chloro-1H-1,2,4-triazol-3-yl)phenol?
The IUPAC name of 3-(5-chloro-1H-1,2,4-triazol-3-yl)phenol (CID 84666531) is 3-(5-chloro-1H-1,2,4-triazol-3-yl)phenol.
What is the SMILES notation for 3-(5-chloro-1H-1,2,4-triazol-3-yl)phenol?
The canonical SMILES for 3-(5-chloro-1H-1,2,4-triazol-3-yl)phenol is Oc1cccc(-c2n[nH]c(Cl)n2)c1.
What is the InChIKey of 3-(5-chloro-1H-1,2,4-triazol-3-yl)phenol?
The InChIKey is UOFHYCLSDJAYLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClN3O/c9-8-10-7(11-12-8)5-2-1-3-6(13)4-5/h1-4,13H,(H,10,11,12).
What are the key properties of 3-(5-chloro-1H-1,2,4-triazol-3-yl)phenol?
3-(5-chloro-1H-1,2,4-triazol-3-yl)phenol has a molecular weight of 195.61 g/mol, XLogP of 1.83, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-chloro-1H-1,2,4-triazol-3-yl)phenol is sourced from PubChem (CID 84666531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).