3-amino-3-imidazo[1,2-a]pyrazin-8-ylpropanoic acid

C9H10N4O2 — CID 84673988

IUPAC3-amino-3-imidazo[1,2-a]pyrazin-8-ylpropanoic acid
SMILESNC(CC(=O)O)c1nccn2ccnc12
InChIInChI=1S/C9H10N4O2/c10-6(5-7(14)15)8-9-12-2-4-13(9)3-1-11-8/h1-4,6H,5,10H2,(H,14,15)
InChIKeyGHSIBDXYWXVTJG-UHFFFAOYSA-N
MW206.20 g/mol
LogP0.20
Rot. Bonds3

About 3-amino-3-imidazo[1,2-a]pyrazin-8-ylpropanoic acid

3-amino-3-imidazo[1,2-a]pyrazin-8-ylpropanoic acid (PubChem CID 84673988) has the molecular formula C9H10N4O2 and a molecular weight of 206.20 g/mol. Its IUPAC name is 3-amino-3-imidazo[1,2-a]pyrazin-8-ylpropanoic acid.

Molecular Properties

Compound Name3-amino-3-imidazo[1,2-a]pyrazin-8-ylpropanoic acid
PubChem CID84673988
Molecular FormulaC9H10N4O2
Molecular Weight206.20 g/mol
Exact Mass206.08
IUPAC Name3-amino-3-imidazo[1,2-a]pyrazin-8-ylpropanoic acid
SMILESNC(CC(=O)O)c1nccn2ccnc12
InChIInChI=1S/C9H10N4O2/c10-6(5-7(14)15)8-9-12-2-4-13(9)3-1-11-8/h1-4,6H,5,10H2,(H,14,15)
InChIKeyGHSIBDXYWXVTJG-UHFFFAOYSA-N
XLogP0.20
TPSA93.51 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.20
LogP ≤ 50.20
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 3-amino-3-imidazo[1,2-a]pyrazin-8-ylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-3-imidazo[1,2-a]pyrazin-8-ylpropanoic acid?
The IUPAC name of 3-amino-3-imidazo[1,2-a]pyrazin-8-ylpropanoic acid (CID 84673988) is 3-amino-3-imidazo[1,2-a]pyrazin-8-ylpropanoic acid.
What is the SMILES notation for 3-amino-3-imidazo[1,2-a]pyrazin-8-ylpropanoic acid?
The canonical SMILES for 3-amino-3-imidazo[1,2-a]pyrazin-8-ylpropanoic acid is NC(CC(=O)O)c1nccn2ccnc12.
What is the InChIKey of 3-amino-3-imidazo[1,2-a]pyrazin-8-ylpropanoic acid?
The InChIKey is GHSIBDXYWXVTJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2/c10-6(5-7(14)15)8-9-12-2-4-13(9)3-1-11-8/h1-4,6H,5,10H2,(H,14,15).
What are the key properties of 3-amino-3-imidazo[1,2-a]pyrazin-8-ylpropanoic acid?
3-amino-3-imidazo[1,2-a]pyrazin-8-ylpropanoic acid has a molecular weight of 206.20 g/mol, XLogP of 0.20, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3-imidazo[1,2-a]pyrazin-8-ylpropanoic acid is sourced from PubChem (CID 84673988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).