C10H20F2N2 — CID 84674360
3-[1-(2,2-difluoroethyl)piperidin-3-yl]propan-1-amine (PubChem CID 84674360) has the molecular formula C10H20F2N2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 3-[1-(2,2-difluoroethyl)piperidin-3-yl]propan-1-amine.
| Compound Name | 3-[1-(2,2-difluoroethyl)piperidin-3-yl]propan-1-amine |
|---|---|
| PubChem CID | 84674360 |
| Molecular Formula | C10H20F2N2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.16 |
| IUPAC Name | 3-[1-(2,2-difluoroethyl)piperidin-3-yl]propan-1-amine |
| SMILES | NCCCC1CCCN(CC(F)F)C1 |
| InChI | InChI=1S/C10H20F2N2/c11-10(12)8-14-6-2-4-9(7-14)3-1-5-13/h9-10H,1-8,13H2 |
| InChIKey | NQEURUSGOHBQMO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |