C14H18F2INO — CID 165429355
1-(2,2-difluoroethyl)-3-[(4-iodophenoxy)methyl]piperidine (PubChem CID 165429355) has the molecular formula C14H18F2INO and a molecular weight of 381.20 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-[(4-iodophenoxy)methyl]piperidine.
| Compound Name | 1-(2,2-difluoroethyl)-3-[(4-iodophenoxy)methyl]piperidine |
|---|---|
| PubChem CID | 165429355 |
| Molecular Formula | C14H18F2INO |
| Molecular Weight | 381.20 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-[(4-iodophenoxy)methyl]piperidine |
| SMILES | FC(F)CN1CCCC(COc2ccc(I)cc2)C1 |
| InChI | InChI=1S/C14H18F2INO/c15-14(16)9-18-7-1-2-11(8-18)10-19-13-5-3-12(17)4-6-13/h3-6,11,14H,1-2,7-10H2 |
| InChIKey | WZCDLJVJXIHPMT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.20 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|