C14H19ClF2INO — CID 165429342
(3S)-1-(2,2-difluoroethyl)-3-[(4-iodophenoxy)methyl]piperidine;hydrochloride (PubChem CID 165429342) has the molecular formula C14H19ClF2INO and a molecular weight of 417.67 g/mol. Its IUPAC name is (3S)-1-(2,2-difluoroethyl)-3-[(4-iodophenoxy)methyl]piperidine;hydrochloride.
| Compound Name | (3S)-1-(2,2-difluoroethyl)-3-[(4-iodophenoxy)methyl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 165429342 |
| Molecular Formula | C14H19ClF2INO |
| Molecular Weight | 417.67 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | (3S)-1-(2,2-difluoroethyl)-3-[(4-iodophenoxy)methyl]piperidine;hydrochloride |
| SMILES | Cl.FC(F)CN1CCC[C@H](COc2ccc(I)cc2)C1 |
| InChI | InChI=1S/C14H18F2INO.ClH/c15-14(16)9-18-7-1-2-11(8-18)10-19-13-5-3-12(17)4-6-13;/h3-6,11,14H,1-2,7-10H2;1H/t11-;/m0./s1 |
| InChIKey | ABKQMAWNXXGRDP-MERQFXBCSA-N |
| XLogP | 4.07 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.67 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|