About 2-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]propan-2-ol
2-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]propan-2-ol (PubChem CID 84695519) has the molecular formula C12H15F3O
and a molecular weight of 232.24 g/mol. Its IUPAC name is 2-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]propan-2-ol.
Molecular Properties
| Compound Name | 2-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]propan-2-ol |
| PubChem CID | 84695519 |
| Molecular Formula | C12H15F3O |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 2-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]propan-2-ol |
| SMILES | CC(C)(O)c1cc(C(C)(C)F)cc(F)c1F |
| InChI | InChI=1S/C12H15F3O/c1-11(2,15)7-5-8(12(3,4)16)10(14)9(13)6-7/h5-6,16H,1-4H3 |
| InChIKey | CNSUXBVTTXWKSR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]propan-2-ol?
The IUPAC name of 2-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]propan-2-ol (CID 84695519) is 2-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]propan-2-ol.
What is the SMILES notation for 2-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]propan-2-ol?
The canonical SMILES for 2-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]propan-2-ol is CC(C)(O)c1cc(C(C)(C)F)cc(F)c1F.
What is the InChIKey of 2-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]propan-2-ol?
The InChIKey is CNSUXBVTTXWKSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F3O/c1-11(2,15)7-5-8(12(3,4)16)10(14)9(13)6-7/h5-6,16H,1-4H3.
What are the key properties of 2-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]propan-2-ol?
2-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]propan-2-ol has a molecular weight of 232.24 g/mol, XLogP of 3.40, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]propan-2-ol is sourced from PubChem (CID 84695519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).