About 6-bromo-4H-indeno[1,2-d][1,2]oxazole
6-bromo-4H-indeno[1,2-d][1,2]oxazole (PubChem CID 84699212) has the molecular formula C10H6BrNO
and a molecular weight of 236.07 g/mol. Its IUPAC name is 6-bromo-4H-indeno[1,2-d][1,2]oxazole.
Molecular Properties
| Compound Name | 6-bromo-4H-indeno[1,2-d][1,2]oxazole |
| PubChem CID | 84699212 |
| Molecular Formula | C10H6BrNO |
| Molecular Weight | 236.07 g/mol |
| Exact Mass | 234.96 |
| IUPAC Name | 6-bromo-4H-indeno[1,2-d][1,2]oxazole |
| SMILES | Brc1ccc2c(c1)Cc1oncc1-2 |
| InChI | InChI=1S/C10H6BrNO/c11-7-1-2-8-6(3-7)4-10-9(8)5-12-13-10/h1-3,5H,4H2 |
| InChIKey | KJOMZQWACHFYMD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.07 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-4H-indeno[1,2-d][1,2]oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4H-indeno[1,2-d][1,2]oxazole?
The IUPAC name of 6-bromo-4H-indeno[1,2-d][1,2]oxazole (CID 84699212) is 6-bromo-4H-indeno[1,2-d][1,2]oxazole.
What is the SMILES notation for 6-bromo-4H-indeno[1,2-d][1,2]oxazole?
The canonical SMILES for 6-bromo-4H-indeno[1,2-d][1,2]oxazole is Brc1ccc2c(c1)Cc1oncc1-2.
What is the InChIKey of 6-bromo-4H-indeno[1,2-d][1,2]oxazole?
The InChIKey is KJOMZQWACHFYMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6BrNO/c11-7-1-2-8-6(3-7)4-10-9(8)5-12-13-10/h1-3,5H,4H2.
What are the key properties of 6-bromo-4H-indeno[1,2-d][1,2]oxazole?
6-bromo-4H-indeno[1,2-d][1,2]oxazole has a molecular weight of 236.07 g/mol, XLogP of 3.01, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4H-indeno[1,2-d][1,2]oxazole is sourced from PubChem (CID 84699212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).