About 9-[bis(methylsulfanyl)methylidene]-2,7-dibromofluorene;2,7-dibromo-9H-fluorene
9-[bis(methylsulfanyl)methylidene]-2,7-dibromofluorene;2,7-dibromo-9H-fluorene (PubChem CID 162206564) has the molecular formula C29H20Br4S2
and a molecular weight of 752.23 g/mol. Its IUPAC name is 9-[bis(methylsulfanyl)methylidene]-2,7-dibromofluorene;2,7-dibromo-9H-fluorene.
Molecular Properties
| Compound Name | 9-[bis(methylsulfanyl)methylidene]-2,7-dibromofluorene;2,7-dibromo-9H-fluorene |
| PubChem CID | 162206564 |
| Molecular Formula | C29H20Br4S2 |
| Molecular Weight | 752.23 g/mol |
| Exact Mass | 747.77 |
| IUPAC Name | 9-[bis(methylsulfanyl)methylidene]-2,7-dibromofluorene;2,7-dibromo-9H-fluorene |
| SMILES | Brc1ccc2c(c1)Cc1cc(Br)ccc1-2.CSC(SC)=C1c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C16H12Br2S2.C13H8Br2/c1-19-16(20-2)15-13-7-9(17)3-5-11(13)12-6-4-10(18)8-14(12)15;14-10-1-3-12-8(6-10)5-9-7-11(15)2-4-13(9)12/h3-8H,1-2H3;1-4,6-7H,5H2 |
| InChIKey | ZSGRBCQCVIZILH-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 752.23 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-[bis(methylsulfanyl)methylidene]-2,7-dibromofluorene;2,7-dibromo-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[bis(methylsulfanyl)methylidene]-2,7-dibromofluorene;2,7-dibromo-9H-fluorene?
The IUPAC name of 9-[bis(methylsulfanyl)methylidene]-2,7-dibromofluorene;2,7-dibromo-9H-fluorene (CID 162206564) is 9-[bis(methylsulfanyl)methylidene]-2,7-dibromofluorene;2,7-dibromo-9H-fluorene.
What is the SMILES notation for 9-[bis(methylsulfanyl)methylidene]-2,7-dibromofluorene;2,7-dibromo-9H-fluorene?
The canonical SMILES for 9-[bis(methylsulfanyl)methylidene]-2,7-dibromofluorene;2,7-dibromo-9H-fluorene is Brc1ccc2c(c1)Cc1cc(Br)ccc1-2.CSC(SC)=C1c2cc(Br)ccc2-c2ccc(Br)cc21.
What is the InChIKey of 9-[bis(methylsulfanyl)methylidene]-2,7-dibromofluorene;2,7-dibromo-9H-fluorene?
The InChIKey is ZSGRBCQCVIZILH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Br2S2.C13H8Br2/c1-19-16(20-2)15-13-7-9(17)3-5-11(13)12-6-4-10(18)8-14(12)15;14-10-1-3-12-8(6-10)5-9-7-11(15)2-4-13(9)12/h3-8H,1-2H3;1-4,6-7H,5H2.
What are the key properties of 9-[bis(methylsulfanyl)methylidene]-2,7-dibromofluorene;2,7-dibromo-9H-fluorene?
9-[bis(methylsulfanyl)methylidene]-2,7-dibromofluorene;2,7-dibromo-9H-fluorene has a molecular weight of 752.23 g/mol, XLogP of 11.42, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[bis(methylsulfanyl)methylidene]-2,7-dibromofluorene;2,7-dibromo-9H-fluorene is sourced from PubChem (CID 162206564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).