C10H9Br — CID 170045023
6-bromo-1,4-dihydronaphthalene (PubChem CID 170045023) has the molecular formula C10H9Br and a molecular weight of 209.09 g/mol. Its IUPAC name is 6-bromo-1,4-dihydronaphthalene.
| Compound Name | 6-bromo-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 170045023 |
| Molecular Formula | C10H9Br |
| Molecular Weight | 209.09 g/mol |
| Exact Mass | 207.99 |
| IUPAC Name | 6-bromo-1,4-dihydronaphthalene |
| SMILES | Brc1ccc2c(c1)CC=CC2 |
| InChI | InChI=1S/C10H9Br/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-2,5-7H,3-4H2 |
| InChIKey | ZOMQGEUFKIKXJB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.09 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|