C11H15BrO — CID 84703706
2-(2-bromo-3,5-dimethylphenyl)propan-2-ol (PubChem CID 84703706) has the molecular formula C11H15BrO and a molecular weight of 243.14 g/mol. Its IUPAC name is 2-(2-bromo-3,5-dimethylphenyl)propan-2-ol.
| Compound Name | 2-(2-bromo-3,5-dimethylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 84703706 |
| Molecular Formula | C11H15BrO |
| Molecular Weight | 243.14 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 2-(2-bromo-3,5-dimethylphenyl)propan-2-ol |
| SMILES | Cc1cc(C)c(Br)c(C(C)(C)O)c1 |
| InChI | InChI=1S/C11H15BrO/c1-7-5-8(2)10(12)9(6-7)11(3,4)13/h5-6,13H,1-4H3 |
| InChIKey | XUWRSQAVVWWKGQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.14 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |