C13H9ClN2O — CID 84704658
5-chloro-2-(3-methylphenyl)-[1,3]oxazolo[4,5-b]pyridine (PubChem CID 84704658) has the molecular formula C13H9ClN2O and a molecular weight of 244.68 g/mol. Its IUPAC name is 5-chloro-2-(3-methylphenyl)-[1,3]oxazolo[4,5-b]pyridine.
| Compound Name | 5-chloro-2-(3-methylphenyl)-[1,3]oxazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 84704658 |
| Molecular Formula | C13H9ClN2O |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 5-chloro-2-(3-methylphenyl)-[1,3]oxazolo[4,5-b]pyridine |
| SMILES | Cc1cccc(-c2nc3nc(Cl)ccc3o2)c1 |
| InChI | InChI=1S/C13H9ClN2O/c1-8-3-2-4-9(7-8)13-16-12-10(17-13)5-6-11(14)15-12/h2-7H,1H3 |
| InChIKey | RSDACZGPDNXFAU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|