C6H2Cl2N2O — CID 84661804
2,5-dichloro-[1,3]oxazolo[4,5-b]pyridine (PubChem CID 84661804) has the molecular formula C6H2Cl2N2O and a molecular weight of 189.00 g/mol. Its IUPAC name is 2,5-dichloro-[1,3]oxazolo[4,5-b]pyridine.
| Compound Name | 2,5-dichloro-[1,3]oxazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 84661804 |
| Molecular Formula | C6H2Cl2N2O |
| Molecular Weight | 189.00 g/mol |
| Exact Mass | 187.95 |
| IUPAC Name | 2,5-dichloro-[1,3]oxazolo[4,5-b]pyridine |
| SMILES | Clc1ccc2oc(Cl)nc2n1 |
| InChI | InChI=1S/C6H2Cl2N2O/c7-4-2-1-3-5(9-4)10-6(8)11-3/h1-2H |
| InChIKey | AQOJXSNKUOPJTJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.00 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|