C19H14Cl2N4O2 — CID 155707882
1-[4-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperazin-1-yl]-3-(4-chlorophenyl)prop-2-yn-1-one (PubChem CID 155707882) has the molecular formula C19H14Cl2N4O2 and a molecular weight of 401.25 g/mol. Its IUPAC name is 1-[4-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperazin-1-yl]-3-(4-chlorophenyl)prop-2-yn-1-one.
| Compound Name | 1-[4-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperazin-1-yl]-3-(4-chlorophenyl)prop-2-yn-1-one |
|---|---|
| PubChem CID | 155707882 |
| Molecular Formula | C19H14Cl2N4O2 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 1-[4-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperazin-1-yl]-3-(4-chlorophenyl)prop-2-yn-1-one |
| SMILES | O=C(C#Cc1ccc(Cl)cc1)N1CCN(c2nc3nc(Cl)ccc3o2)CC1 |
| InChI | InChI=1S/C19H14Cl2N4O2/c20-14-4-1-13(2-5-14)3-8-17(26)24-9-11-25(12-10-24)19-23-18-15(27-19)6-7-16(21)22-18/h1-2,4-7H,9-12H2 |
| InChIKey | MQRAKESETVGBQD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|