C23H24ClN7O2 — CID 155192550
[4-(1-tert-butyltriazol-4-yl)phenyl]-[4-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperazin-1-yl]methanone (PubChem CID 155192550) has the molecular formula C23H24ClN7O2 and a molecular weight of 465.95 g/mol. Its IUPAC name is [4-(1-tert-butyltriazol-4-yl)phenyl]-[4-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperazin-1-yl]methanone.
| Compound Name | [4-(1-tert-butyltriazol-4-yl)phenyl]-[4-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 155192550 |
| Molecular Formula | C23H24ClN7O2 |
| Molecular Weight | 465.95 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | [4-(1-tert-butyltriazol-4-yl)phenyl]-[4-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperazin-1-yl]methanone |
| SMILES | CC(C)(C)n1cc(-c2ccc(C(=O)N3CCN(c4nc5nc(Cl)ccc5o4)CC3)cc2)nn1 |
| InChI | InChI=1S/C23H24ClN7O2/c1-23(2,3)31-14-17(27-28-31)15-4-6-16(7-5-15)21(32)29-10-12-30(13-11-29)22-26-20-18(33-22)8-9-19(24)25-20/h4-9,14H,10-13H2,1-3H3 |
| InChIKey | OASPMOKWIBDXNN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 93.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.95 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|