C12H13ClN4O3 — CID 155192416
4-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)-2-methylpiperazine-1-carboxylic acid (PubChem CID 155192416) has the molecular formula C12H13ClN4O3 and a molecular weight of 296.71 g/mol. Its IUPAC name is 4-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)-2-methylpiperazine-1-carboxylic acid.
| Compound Name | 4-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)-2-methylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 155192416 |
| Molecular Formula | C12H13ClN4O3 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 4-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)-2-methylpiperazine-1-carboxylic acid |
| SMILES | CC1CN(c2nc3nc(Cl)ccc3o2)CCN1C(=O)O |
| InChI | InChI=1S/C12H13ClN4O3/c1-7-6-16(4-5-17(7)12(18)19)11-15-10-8(20-11)2-3-9(13)14-10/h2-3,7H,4-6H2,1H3,(H,18,19) |
| InChIKey | ZOGUHTJMJKQUMM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|