C10H10ClN3O2 — CID 118224361
5-chloro-2-morpholin-4-yl-[1,3]oxazolo[4,5-b]pyridine (PubChem CID 118224361) has the molecular formula C10H10ClN3O2 and a molecular weight of 239.66 g/mol. Its IUPAC name is 5-chloro-2-morpholin-4-yl-[1,3]oxazolo[4,5-b]pyridine.
| Compound Name | 5-chloro-2-morpholin-4-yl-[1,3]oxazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 118224361 |
| Molecular Formula | C10H10ClN3O2 |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 5-chloro-2-morpholin-4-yl-[1,3]oxazolo[4,5-b]pyridine |
| SMILES | Clc1ccc2oc(N3CCOCC3)nc2n1 |
| InChI | InChI=1S/C10H10ClN3O2/c11-8-2-1-7-9(12-8)13-10(16-7)14-3-5-15-6-4-14/h1-2H,3-6H2 |
| InChIKey | STFICNVJTLVTRM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|