C15H19ClN4O — CID 170171730
5-chloro-2-(7-methyl-2,3,4,4a,5,6,8,8a-octahydro-1,7-naphthyridin-1-yl)-[1,3]oxazolo[4,5-b]pyridine (PubChem CID 170171730) has the molecular formula C15H19ClN4O and a molecular weight of 306.80 g/mol. Its IUPAC name is 5-chloro-2-(7-methyl-2,3,4,4a,5,6,8,8a-octahydro-1,7-naphthyridin-1-yl)-[1,3]oxazolo[4,5-b]pyridine.
| Compound Name | 5-chloro-2-(7-methyl-2,3,4,4a,5,6,8,8a-octahydro-1,7-naphthyridin-1-yl)-[1,3]oxazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 170171730 |
| Molecular Formula | C15H19ClN4O |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 5-chloro-2-(7-methyl-2,3,4,4a,5,6,8,8a-octahydro-1,7-naphthyridin-1-yl)-[1,3]oxazolo[4,5-b]pyridine |
| SMILES | CN1CCC2CCCN(c3nc4nc(Cl)ccc4o3)C2C1 |
| InChI | InChI=1S/C15H19ClN4O/c1-19-8-6-10-3-2-7-20(11(10)9-19)15-18-14-12(21-15)4-5-13(16)17-14/h4-5,10-11H,2-3,6-9H2,1H3 |
| InChIKey | DJZKSQXKYCNHEX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|