C13H15ClN4O — CID 171778124
2-(2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridin-1-yl)-5-chloro-[1,3]oxazolo[4,5-b]pyridine (PubChem CID 171778124) has the molecular formula C13H15ClN4O and a molecular weight of 278.74 g/mol. Its IUPAC name is 2-(2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridin-1-yl)-5-chloro-[1,3]oxazolo[4,5-b]pyridine.
| Compound Name | 2-(2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridin-1-yl)-5-chloro-[1,3]oxazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 171778124 |
| Molecular Formula | C13H15ClN4O |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-(2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridin-1-yl)-5-chloro-[1,3]oxazolo[4,5-b]pyridine |
| SMILES | Clc1ccc2oc(N3CCC4CCNCC43)nc2n1 |
| InChI | InChI=1S/C13H15ClN4O/c14-11-2-1-10-12(16-11)17-13(19-10)18-6-4-8-3-5-15-7-9(8)18/h1-2,8-9,15H,3-7H2 |
| InChIKey | TXEWDDAJOXIVGD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|