C18H17ClN4O3 — CID 175179983
[4-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)-2-methoxypiperazin-1-yl]-phenylmethanone (PubChem CID 175179983) has the molecular formula C18H17ClN4O3 and a molecular weight of 372.81 g/mol. Its IUPAC name is [4-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)-2-methoxypiperazin-1-yl]-phenylmethanone.
| Compound Name | [4-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)-2-methoxypiperazin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 175179983 |
| Molecular Formula | C18H17ClN4O3 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | [4-(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)-2-methoxypiperazin-1-yl]-phenylmethanone |
| SMILES | COC1CN(c2nc3nc(Cl)ccc3o2)CCN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H17ClN4O3/c1-25-15-11-22(18-21-16-13(26-18)7-8-14(19)20-16)9-10-23(15)17(24)12-5-3-2-4-6-12/h2-8,15H,9-11H2,1H3 |
| InChIKey | RFDCYKJHPNQDRK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 71.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|