C14H13N3O — CID 143409028
3-(5-ethyl-[1,3]oxazolo[4,5-b]pyridin-2-yl)aniline (PubChem CID 143409028) has the molecular formula C14H13N3O and a molecular weight of 239.28 g/mol. Its IUPAC name is 3-(5-ethyl-[1,3]oxazolo[4,5-b]pyridin-2-yl)aniline.
| Compound Name | 3-(5-ethyl-[1,3]oxazolo[4,5-b]pyridin-2-yl)aniline |
|---|---|
| PubChem CID | 143409028 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 3-(5-ethyl-[1,3]oxazolo[4,5-b]pyridin-2-yl)aniline |
| SMILES | CCc1ccc2oc(-c3cccc(N)c3)nc2n1 |
| InChI | InChI=1S/C14H13N3O/c1-2-11-6-7-12-13(16-11)17-14(18-12)9-4-3-5-10(15)8-9/h3-8H,2,15H2,1H3 |
| InChIKey | ILJILBAKSLJKQA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|