C11H11F3N2S — CID 84710188
2-[2-(trifluoromethyl)-1,3-benzothiazol-5-yl]propan-1-amine (PubChem CID 84710188) has the molecular formula C11H11F3N2S and a molecular weight of 260.28 g/mol. Its IUPAC name is 2-[2-(trifluoromethyl)-1,3-benzothiazol-5-yl]propan-1-amine.
| Compound Name | 2-[2-(trifluoromethyl)-1,3-benzothiazol-5-yl]propan-1-amine |
|---|---|
| PubChem CID | 84710188 |
| Molecular Formula | C11H11F3N2S |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 2-[2-(trifluoromethyl)-1,3-benzothiazol-5-yl]propan-1-amine |
| SMILES | CC(CN)c1ccc2sc(C(F)(F)F)nc2c1 |
| InChI | InChI=1S/C11H11F3N2S/c1-6(5-15)7-2-3-9-8(4-7)16-10(17-9)11(12,13)14/h2-4,6H,5,15H2,1H3 |
| InChIKey | UNQKAEGVYGUSOM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |