C10H6F3NOS — CID 84704981
1-[2-(trifluoromethyl)-1,3-benzothiazol-5-yl]ethanone (PubChem CID 84704981) has the molecular formula C10H6F3NOS and a molecular weight of 245.22 g/mol. Its IUPAC name is 1-[2-(trifluoromethyl)-1,3-benzothiazol-5-yl]ethanone.
| Compound Name | 1-[2-(trifluoromethyl)-1,3-benzothiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 84704981 |
| Molecular Formula | C10H6F3NOS |
| Molecular Weight | 245.22 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | 1-[2-(trifluoromethyl)-1,3-benzothiazol-5-yl]ethanone |
| SMILES | CC(=O)c1ccc2sc(C(F)(F)F)nc2c1 |
| InChI | InChI=1S/C10H6F3NOS/c1-5(15)6-2-3-8-7(4-6)14-9(16-8)10(11,12)13/h2-4H,1H3 |
| InChIKey | KOTLLFZVZBIPAV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.22 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |