C10H14BrNO3 — CID 84714360
2-(1-aminoethyl)-3-bromo-4,5-dimethoxyphenol (PubChem CID 84714360) has the molecular formula C10H14BrNO3 and a molecular weight of 276.13 g/mol. Its IUPAC name is 2-(1-aminoethyl)-3-bromo-4,5-dimethoxyphenol.
| Compound Name | 2-(1-aminoethyl)-3-bromo-4,5-dimethoxyphenol |
|---|---|
| PubChem CID | 84714360 |
| Molecular Formula | C10H14BrNO3 |
| Molecular Weight | 276.13 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 2-(1-aminoethyl)-3-bromo-4,5-dimethoxyphenol |
| SMILES | COc1cc(O)c(C(C)N)c(Br)c1OC |
| InChI | InChI=1S/C10H14BrNO3/c1-5(12)8-6(13)4-7(14-2)10(15-3)9(8)11/h4-5,13H,12H2,1-3H3 |
| InChIKey | ITGKNNQWFLPXHT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.13 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|