About 3-(4-hydroxyphenyl)-2H-1,2-oxazol-5-one
3-(4-hydroxyphenyl)-2H-1,2-oxazol-5-one (PubChem CID 84717837) has the molecular formula C9H7NO3
and a molecular weight of 177.16 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-2H-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | 3-(4-hydroxyphenyl)-2H-1,2-oxazol-5-one |
| PubChem CID | 84717837 |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 3-(4-hydroxyphenyl)-2H-1,2-oxazol-5-one |
| SMILES | O=c1cc(-c2ccc(O)cc2)[nH]o1 |
| InChI | InChI=1S/C9H7NO3/c11-7-3-1-6(2-4-7)8-5-9(12)13-10-8/h1-5,10-11H |
| InChIKey | FSZHBYKWMKECDN-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-hydroxyphenyl)-2H-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-hydroxyphenyl)-2H-1,2-oxazol-5-one?
The IUPAC name of 3-(4-hydroxyphenyl)-2H-1,2-oxazol-5-one (CID 84717837) is 3-(4-hydroxyphenyl)-2H-1,2-oxazol-5-one.
What is the SMILES notation for 3-(4-hydroxyphenyl)-2H-1,2-oxazol-5-one?
The canonical SMILES for 3-(4-hydroxyphenyl)-2H-1,2-oxazol-5-one is O=c1cc(-c2ccc(O)cc2)[nH]o1.
What is the InChIKey of 3-(4-hydroxyphenyl)-2H-1,2-oxazol-5-one?
The InChIKey is FSZHBYKWMKECDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO3/c11-7-3-1-6(2-4-7)8-5-9(12)13-10-8/h1-5,10-11H.
What are the key properties of 3-(4-hydroxyphenyl)-2H-1,2-oxazol-5-one?
3-(4-hydroxyphenyl)-2H-1,2-oxazol-5-one has a molecular weight of 177.16 g/mol, XLogP of 1.34, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-hydroxyphenyl)-2H-1,2-oxazol-5-one is sourced from PubChem (CID 84717837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).