C10H9NO3 — CID 84719617
3-(4-hydroxyphenyl)-4-methyl-2H-1,2-oxazol-5-one (PubChem CID 84719617) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-4-methyl-2H-1,2-oxazol-5-one.
| Compound Name | 3-(4-hydroxyphenyl)-4-methyl-2H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 84719617 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 3-(4-hydroxyphenyl)-4-methyl-2H-1,2-oxazol-5-one |
| SMILES | Cc1c(-c2ccc(O)cc2)[nH]oc1=O |
| InChI | InChI=1S/C10H9NO3/c1-6-9(11-14-10(6)13)7-2-4-8(12)5-3-7/h2-5,11-12H,1H3 |
| InChIKey | RSGBQFGBALJYDT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |