C10H9NO3 — CID 105444699
5-(4-hydroxyphenyl)-4-methyl-3H-1,3-oxazol-2-one (PubChem CID 105444699) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is 5-(4-hydroxyphenyl)-4-methyl-3H-1,3-oxazol-2-one.
| Compound Name | 5-(4-hydroxyphenyl)-4-methyl-3H-1,3-oxazol-2-one |
|---|---|
| PubChem CID | 105444699 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 5-(4-hydroxyphenyl)-4-methyl-3H-1,3-oxazol-2-one |
| SMILES | Cc1[nH]c(=O)oc1-c1ccc(O)cc1 |
| InChI | InChI=1S/C10H9NO3/c1-6-9(14-10(13)11-6)7-2-4-8(12)5-3-7/h2-5,12H,1H3,(H,11,13) |
| InChIKey | RQRBZTRULLCJAF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |