About 6-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine
6-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine (PubChem CID 84721400) has the molecular formula C7H5F3N4
and a molecular weight of 202.14 g/mol. Its IUPAC name is 6-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine.
Analyze 6-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine?
The IUPAC name of 6-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine (CID 84721400) is 6-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine.
What is the SMILES notation for 6-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine?
The canonical SMILES for 6-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine is Nc1cnn2cc(C(F)(F)F)cnc12.
What is the InChIKey of 6-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine?
The InChIKey is YDYMBPPTKQVKCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F3N4/c8-7(9,10)4-1-12-6-5(11)2-13-14(6)3-4/h1-3H,11H2.
What are the key properties of 6-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine?
6-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine has a molecular weight of 202.14 g/mol, XLogP of 1.33, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine is sourced from PubChem (CID 84721400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).