C10H17F4N — CID 84735882
[4-(2,3,3,3-tetrafluoropropyl)cyclohexyl]methanamine (PubChem CID 84735882) has the molecular formula C10H17F4N and a molecular weight of 227.24 g/mol. Its IUPAC name is [4-(2,3,3,3-tetrafluoropropyl)cyclohexyl]methanamine.
| Compound Name | [4-(2,3,3,3-tetrafluoropropyl)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 84735882 |
| Molecular Formula | C10H17F4N |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | [4-(2,3,3,3-tetrafluoropropyl)cyclohexyl]methanamine |
| SMILES | NCC1CCC(CC(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H17F4N/c11-9(10(12,13)14)5-7-1-3-8(6-15)4-2-7/h7-9H,1-6,15H2 |
| InChIKey | ATRXRMNYKCHTSS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |