C9H13BrF4 — CID 84738909
1-(bromomethyl)-4-(1,2,2,2-tetrafluoroethyl)cyclohexane (PubChem CID 84738909) has the molecular formula C9H13BrF4 and a molecular weight of 277.10 g/mol. Its IUPAC name is 1-(bromomethyl)-4-(1,2,2,2-tetrafluoroethyl)cyclohexane.
| Compound Name | 1-(bromomethyl)-4-(1,2,2,2-tetrafluoroethyl)cyclohexane |
|---|---|
| PubChem CID | 84738909 |
| Molecular Formula | C9H13BrF4 |
| Molecular Weight | 277.10 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 1-(bromomethyl)-4-(1,2,2,2-tetrafluoroethyl)cyclohexane |
| SMILES | FC(C1CCC(CBr)CC1)C(F)(F)F |
| InChI | InChI=1S/C9H13BrF4/c10-5-6-1-3-7(4-2-6)8(11)9(12,13)14/h6-8H,1-5H2 |
| InChIKey | ZWKDXTJZOQMZPO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.10 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|