About 1-(bromomethyl)-4-(1,2,2,2-tetrafluoroethyl)cyclohexane
1-(bromomethyl)-4-(1,2,2,2-tetrafluoroethyl)cyclohexane (PubChem CID 84738909) has the molecular formula C9H13BrF4
and a molecular weight of 277.10 g/mol. Its IUPAC name is 1-(bromomethyl)-4-(1,2,2,2-tetrafluoroethyl)cyclohexane.
Molecular Properties
| Compound Name | 1-(bromomethyl)-4-(1,2,2,2-tetrafluoroethyl)cyclohexane |
| PubChem CID | 84738909 |
| Molecular Formula | C9H13BrF4 |
| Molecular Weight | 277.10 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 1-(bromomethyl)-4-(1,2,2,2-tetrafluoroethyl)cyclohexane |
| SMILES | FC(C1CCC(CBr)CC1)C(F)(F)F |
| InChI | InChI=1S/C9H13BrF4/c10-5-6-1-3-7(4-2-6)8(11)9(12,13)14/h6-8H,1-5H2 |
| InChIKey | ZWKDXTJZOQMZPO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.10 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(bromomethyl)-4-(1,2,2,2-tetrafluoroethyl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(bromomethyl)-4-(1,2,2,2-tetrafluoroethyl)cyclohexane?
The IUPAC name of 1-(bromomethyl)-4-(1,2,2,2-tetrafluoroethyl)cyclohexane (CID 84738909) is 1-(bromomethyl)-4-(1,2,2,2-tetrafluoroethyl)cyclohexane.
What is the SMILES notation for 1-(bromomethyl)-4-(1,2,2,2-tetrafluoroethyl)cyclohexane?
The canonical SMILES for 1-(bromomethyl)-4-(1,2,2,2-tetrafluoroethyl)cyclohexane is FC(C1CCC(CBr)CC1)C(F)(F)F.
What is the InChIKey of 1-(bromomethyl)-4-(1,2,2,2-tetrafluoroethyl)cyclohexane?
The InChIKey is ZWKDXTJZOQMZPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13BrF4/c10-5-6-1-3-7(4-2-6)8(11)9(12,13)14/h6-8H,1-5H2.
What are the key properties of 1-(bromomethyl)-4-(1,2,2,2-tetrafluoroethyl)cyclohexane?
1-(bromomethyl)-4-(1,2,2,2-tetrafluoroethyl)cyclohexane has a molecular weight of 277.10 g/mol, XLogP of 4.09, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(bromomethyl)-4-(1,2,2,2-tetrafluoroethyl)cyclohexane is sourced from PubChem (CID 84738909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).