C10H14F4O — CID 84735787
2-[4-(1,2,2,2-tetrafluoroethyl)cyclohexyl]acetaldehyde (PubChem CID 84735787) has the molecular formula C10H14F4O and a molecular weight of 226.21 g/mol. Its IUPAC name is 2-[4-(1,2,2,2-tetrafluoroethyl)cyclohexyl]acetaldehyde.
| Compound Name | 2-[4-(1,2,2,2-tetrafluoroethyl)cyclohexyl]acetaldehyde |
|---|---|
| PubChem CID | 84735787 |
| Molecular Formula | C10H14F4O |
| Molecular Weight | 226.21 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-[4-(1,2,2,2-tetrafluoroethyl)cyclohexyl]acetaldehyde |
| SMILES | O=CCC1CCC(C(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H14F4O/c11-9(10(12,13)14)8-3-1-7(2-4-8)5-6-15/h6-9H,1-5H2 |
| InChIKey | VEPCLFYSCJZAGW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.21 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|