C14H21N3 — CID 84736264
4-(2,3-dihydroindol-1-ylmethyl)piperidin-4-amine (PubChem CID 84736264) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 4-(2,3-dihydroindol-1-ylmethyl)piperidin-4-amine.
| Compound Name | 4-(2,3-dihydroindol-1-ylmethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 84736264 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 4-(2,3-dihydroindol-1-ylmethyl)piperidin-4-amine |
| SMILES | NC1(CN2CCc3ccccc32)CCNCC1 |
| InChI | InChI=1S/C14H21N3/c15-14(6-8-16-9-7-14)11-17-10-5-12-3-1-2-4-13(12)17/h1-4,16H,5-11,15H2 |
| InChIKey | WWUOOMDQNRPZFA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |