C13H17NOS — CID 84736549
3-(2,3-dihydroindol-1-ylmethyl)thiolan-3-ol (PubChem CID 84736549) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-ylmethyl)thiolan-3-ol.
| Compound Name | 3-(2,3-dihydroindol-1-ylmethyl)thiolan-3-ol |
|---|---|
| PubChem CID | 84736549 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 3-(2,3-dihydroindol-1-ylmethyl)thiolan-3-ol |
| SMILES | OC1(CN2CCc3ccccc32)CCSC1 |
| InChI | InChI=1S/C13H17NOS/c15-13(6-8-16-10-13)9-14-7-5-11-3-1-2-4-12(11)14/h1-4,15H,5-10H2 |
| InChIKey | RHFUBVSZKGBDSR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |