C16H22N2 — CID 84741409
6-ethyl-3,3,9-trimethyl-2,4-dihydro-1H-pyrido[3,4-b]indole (PubChem CID 84741409) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 6-ethyl-3,3,9-trimethyl-2,4-dihydro-1H-pyrido[3,4-b]indole.
| Compound Name | 6-ethyl-3,3,9-trimethyl-2,4-dihydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 84741409 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 6-ethyl-3,3,9-trimethyl-2,4-dihydro-1H-pyrido[3,4-b]indole |
| SMILES | CCc1ccc2c(c1)c1c(n2C)CNC(C)(C)C1 |
| InChI | InChI=1S/C16H22N2/c1-5-11-6-7-14-12(8-11)13-9-16(2,3)17-10-15(13)18(14)4/h6-8,17H,5,9-10H2,1-4H3 |
| InChIKey | ANNQDWJLUMXETO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|