2-(1,3-benzodioxol-5-yl)-2-(2-ethylpiperidin-1-yl)acetic acid

C16H21NO4 — CID 84749040

IUPAC2-(1,3-benzodioxol-5-yl)-2-(2-ethylpiperidin-1-yl)acetic acid
SMILESCCC1CCCCN1C(C(=O)O)c1ccc2c(c1)OCO2
InChIInChI=1S/C16H21NO4/c1-2-12-5-3-4-8-17(12)15(16(18)19)11-6-7-13-14(9-11)21-10-20-13/h6-7,9,12,15H,2-5,8,10H2,1H3,(H,18,19)
InChIKeyWEGDOCCFELTWFA-UHFFFAOYSA-N
MW291.35 g/mol
LogP2.81
Rot. Bonds4

About 2-(1,3-benzodioxol-5-yl)-2-(2-ethylpiperidin-1-yl)acetic acid

2-(1,3-benzodioxol-5-yl)-2-(2-ethylpiperidin-1-yl)acetic acid (PubChem CID 84749040) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-2-(2-ethylpiperidin-1-yl)acetic acid.

Molecular Properties

Compound Name2-(1,3-benzodioxol-5-yl)-2-(2-ethylpiperidin-1-yl)acetic acid
PubChem CID84749040
Molecular FormulaC16H21NO4
Molecular Weight291.35 g/mol
Exact Mass291.15
IUPAC Name2-(1,3-benzodioxol-5-yl)-2-(2-ethylpiperidin-1-yl)acetic acid
SMILESCCC1CCCCN1C(C(=O)O)c1ccc2c(c1)OCO2
InChIInChI=1S/C16H21NO4/c1-2-12-5-3-4-8-17(12)15(16(18)19)11-6-7-13-14(9-11)21-10-20-13/h6-7,9,12,15H,2-5,8,10H2,1H3,(H,18,19)
InChIKeyWEGDOCCFELTWFA-UHFFFAOYSA-N
XLogP2.81
TPSA59.00 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.35
LogP ≤ 52.81
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(1,3-benzodioxol-5-yl)-2-(2-ethylpiperidin-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,3-benzodioxol-5-yl)-2-(2-ethylpiperidin-1-yl)acetic acid?
The IUPAC name of 2-(1,3-benzodioxol-5-yl)-2-(2-ethylpiperidin-1-yl)acetic acid (CID 84749040) is 2-(1,3-benzodioxol-5-yl)-2-(2-ethylpiperidin-1-yl)acetic acid.
What is the SMILES notation for 2-(1,3-benzodioxol-5-yl)-2-(2-ethylpiperidin-1-yl)acetic acid?
The canonical SMILES for 2-(1,3-benzodioxol-5-yl)-2-(2-ethylpiperidin-1-yl)acetic acid is CCC1CCCCN1C(C(=O)O)c1ccc2c(c1)OCO2.
What is the InChIKey of 2-(1,3-benzodioxol-5-yl)-2-(2-ethylpiperidin-1-yl)acetic acid?
The InChIKey is WEGDOCCFELTWFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO4/c1-2-12-5-3-4-8-17(12)15(16(18)19)11-6-7-13-14(9-11)21-10-20-13/h6-7,9,12,15H,2-5,8,10H2,1H3,(H,18,19).
What are the key properties of 2-(1,3-benzodioxol-5-yl)-2-(2-ethylpiperidin-1-yl)acetic acid?
2-(1,3-benzodioxol-5-yl)-2-(2-ethylpiperidin-1-yl)acetic acid has a molecular weight of 291.35 g/mol, XLogP of 2.81, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzodioxol-5-yl)-2-(2-ethylpiperidin-1-yl)acetic acid is sourced from PubChem (CID 84749040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).