C18H28N4O — CID 84755578
2-amino-1-[3-(4-benzylpiperazin-1-yl)piperidin-1-yl]ethanone (PubChem CID 84755578) has the molecular formula C18H28N4O and a molecular weight of 316.45 g/mol. Its IUPAC name is 2-amino-1-[3-(4-benzylpiperazin-1-yl)piperidin-1-yl]ethanone.
| Compound Name | 2-amino-1-[3-(4-benzylpiperazin-1-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 84755578 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | 2-amino-1-[3-(4-benzylpiperazin-1-yl)piperidin-1-yl]ethanone |
| SMILES | NCC(=O)N1CCCC(N2CCN(Cc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C18H28N4O/c19-13-18(23)22-8-4-7-17(15-22)21-11-9-20(10-12-21)14-16-5-2-1-3-6-16/h1-3,5-6,17H,4,7-15,19H2 |
| InChIKey | TWQLZTVWFMGPJE-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |