C8H9N3 — CID 84763015
2-(4,6-dimethylpyrimidin-5-yl)acetonitrile (PubChem CID 84763015) has the molecular formula C8H9N3 and a molecular weight of 147.18 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-5-yl)acetonitrile.
| Compound Name | 2-(4,6-dimethylpyrimidin-5-yl)acetonitrile |
|---|---|
| PubChem CID | 84763015 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-5-yl)acetonitrile |
| SMILES | Cc1ncnc(C)c1CC#N |
| InChI | InChI=1S/C8H9N3/c1-6-8(3-4-9)7(2)11-5-10-6/h5H,3H2,1-2H3 |
| InChIKey | OCGWQAOKEYFDBJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |