About 2-(1,3-dihydrothieno[3,4-c]pyridin-7-yl)acetonitrile
2-(1,3-dihydrothieno[3,4-c]pyridin-7-yl)acetonitrile (PubChem CID 84767216) has the molecular formula C9H8N2S
and a molecular weight of 176.24 g/mol. Its IUPAC name is 2-(1,3-dihydrothieno[3,4-c]pyridin-7-yl)acetonitrile.
Analyze 2-(1,3-dihydrothieno[3,4-c]pyridin-7-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dihydrothieno[3,4-c]pyridin-7-yl)acetonitrile?
The IUPAC name of 2-(1,3-dihydrothieno[3,4-c]pyridin-7-yl)acetonitrile (CID 84767216) is 2-(1,3-dihydrothieno[3,4-c]pyridin-7-yl)acetonitrile.
What is the SMILES notation for 2-(1,3-dihydrothieno[3,4-c]pyridin-7-yl)acetonitrile?
The canonical SMILES for 2-(1,3-dihydrothieno[3,4-c]pyridin-7-yl)acetonitrile is N#CCc1cncc2c1CSC2.
What is the InChIKey of 2-(1,3-dihydrothieno[3,4-c]pyridin-7-yl)acetonitrile?
The InChIKey is GNMUHTRJZMWYLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2S/c10-2-1-7-3-11-4-8-5-12-6-9(7)8/h3-4H,1,5-6H2.
What are the key properties of 2-(1,3-dihydrothieno[3,4-c]pyridin-7-yl)acetonitrile?
2-(1,3-dihydrothieno[3,4-c]pyridin-7-yl)acetonitrile has a molecular weight of 176.24 g/mol, XLogP of 1.89, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dihydrothieno[3,4-c]pyridin-7-yl)acetonitrile is sourced from PubChem (CID 84767216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).