C18H17N — CID 170886247
2-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)acetonitrile (PubChem CID 170886247) has the molecular formula C18H17N and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)acetonitrile.
| Compound Name | 2-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)acetonitrile |
|---|---|
| PubChem CID | 170886247 |
| Molecular Formula | C18H17N |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)acetonitrile |
| SMILES | N#CCc1cc2ccc1CCc1ccc(cc1)CC2 |
| InChI | InChI=1S/C18H17N/c19-12-11-18-13-16-6-5-14-1-3-15(4-2-14)7-9-17(18)10-8-16/h1-4,8,10,13H,5-7,9,11H2 |
| InChIKey | HTRHDWZXUWOTSE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |