About 2-amino-3-(2-bicyclo[2.2.2]octa-1,3,5-trienyl)propanoic acid
2-amino-3-(2-bicyclo[2.2.2]octa-1,3,5-trienyl)propanoic acid (PubChem CID 164530915) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-amino-3-(2-bicyclo[2.2.2]octa-1,3,5-trienyl)propanoic acid.
Analyze 2-amino-3-(2-bicyclo[2.2.2]octa-1,3,5-trienyl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-(2-bicyclo[2.2.2]octa-1,3,5-trienyl)propanoic acid?
The IUPAC name of 2-amino-3-(2-bicyclo[2.2.2]octa-1,3,5-trienyl)propanoic acid (CID 164530915) is 2-amino-3-(2-bicyclo[2.2.2]octa-1,3,5-trienyl)propanoic acid.
What is the SMILES notation for 2-amino-3-(2-bicyclo[2.2.2]octa-1,3,5-trienyl)propanoic acid?
The canonical SMILES for 2-amino-3-(2-bicyclo[2.2.2]octa-1,3,5-trienyl)propanoic acid is NC(Cc1cc2ccc1CC2)C(=O)O.
What is the InChIKey of 2-amino-3-(2-bicyclo[2.2.2]octa-1,3,5-trienyl)propanoic acid?
The InChIKey is RXXNIONHPBYFSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c12-10(11(13)14)6-9-5-7-1-3-8(9)4-2-7/h1,3,5,10H,2,4,6,12H2,(H,13,14).
What are the key properties of 2-amino-3-(2-bicyclo[2.2.2]octa-1,3,5-trienyl)propanoic acid?
2-amino-3-(2-bicyclo[2.2.2]octa-1,3,5-trienyl)propanoic acid has a molecular weight of 191.23 g/mol, XLogP of 0.74, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(2-bicyclo[2.2.2]octa-1,3,5-trienyl)propanoic acid is sourced from PubChem (CID 164530915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).