C8H9BrO — CID 84776022
2-bromo-4,5,6,7-tetrahydro-1-benzofuran (PubChem CID 84776022) has the molecular formula C8H9BrO and a molecular weight of 201.06 g/mol. Its IUPAC name is 2-bromo-4,5,6,7-tetrahydro-1-benzofuran.
| Compound Name | 2-bromo-4,5,6,7-tetrahydro-1-benzofuran |
|---|---|
| PubChem CID | 84776022 |
| Molecular Formula | C8H9BrO |
| Molecular Weight | 201.06 g/mol |
| Exact Mass | 199.98 |
| IUPAC Name | 2-bromo-4,5,6,7-tetrahydro-1-benzofuran |
| SMILES | Brc1cc2c(o1)CCCC2 |
| InChI | InChI=1S/C8H9BrO/c9-8-5-6-3-1-2-4-7(6)10-8/h5H,1-4H2 |
| InChIKey | MLKFFUMPNOCYTA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.06 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |