C10H8O3S — CID 84780162
1-(2-sulfanylidene-4H-1,3-benzodioxin-8-yl)ethanone (PubChem CID 84780162) has the molecular formula C10H8O3S and a molecular weight of 208.24 g/mol. Its IUPAC name is 1-(2-sulfanylidene-4H-1,3-benzodioxin-8-yl)ethanone.
| Compound Name | 1-(2-sulfanylidene-4H-1,3-benzodioxin-8-yl)ethanone |
|---|---|
| PubChem CID | 84780162 |
| Molecular Formula | C10H8O3S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | 1-(2-sulfanylidene-4H-1,3-benzodioxin-8-yl)ethanone |
| SMILES | CC(=O)c1cccc2c1OC(=S)OC2 |
| InChI | InChI=1S/C10H8O3S/c1-6(11)8-4-2-3-7-5-12-10(14)13-9(7)8/h2-4H,5H2,1H3 |
| InChIKey | ULBHIHLQXYUUKS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|