C15H12N2O3 — CID 162768624
9H-xanthene-4,5-dicarboxamide (PubChem CID 162768624) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is 9H-xanthene-4,5-dicarboxamide.
| Compound Name | 9H-xanthene-4,5-dicarboxamide |
|---|---|
| PubChem CID | 162768624 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 9H-xanthene-4,5-dicarboxamide |
| SMILES | NC(=O)c1cccc2c1Oc1c(cccc1C(N)=O)C2 |
| InChI | InChI=1S/C15H12N2O3/c16-14(18)10-5-1-3-8-7-9-4-2-6-11(15(17)19)13(9)20-12(8)10/h1-6H,7H2,(H2,16,18)(H2,17,19) |
| InChIKey | QDSVXJQAUWRIPN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |