About 9H-xanthene-4,5-dicarboxamide
9H-xanthene-4,5-dicarboxamide (PubChem CID 162768624) has the molecular formula C15H12N2O3
and a molecular weight of 268.27 g/mol. Its IUPAC name is 9H-xanthene-4,5-dicarboxamide.
Molecular Properties
| Compound Name | 9H-xanthene-4,5-dicarboxamide |
| PubChem CID | 162768624 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 9H-xanthene-4,5-dicarboxamide |
| SMILES | NC(=O)c1cccc2c1Oc1c(cccc1C(N)=O)C2 |
| InChI | InChI=1S/C15H12N2O3/c16-14(18)10-5-1-3-8-7-9-4-2-6-11(15(17)19)13(9)20-12(8)10/h1-6H,7H2,(H2,16,18)(H2,17,19) |
| InChIKey | QDSVXJQAUWRIPN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9H-xanthene-4,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-xanthene-4,5-dicarboxamide?
The IUPAC name of 9H-xanthene-4,5-dicarboxamide (CID 162768624) is 9H-xanthene-4,5-dicarboxamide.
What is the SMILES notation for 9H-xanthene-4,5-dicarboxamide?
The canonical SMILES for 9H-xanthene-4,5-dicarboxamide is NC(=O)c1cccc2c1Oc1c(cccc1C(N)=O)C2.
What is the InChIKey of 9H-xanthene-4,5-dicarboxamide?
The InChIKey is QDSVXJQAUWRIPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O3/c16-14(18)10-5-1-3-8-7-9-4-2-6-11(15(17)19)13(9)20-12(8)10/h1-6H,7H2,(H2,16,18)(H2,17,19).
What are the key properties of 9H-xanthene-4,5-dicarboxamide?
9H-xanthene-4,5-dicarboxamide has a molecular weight of 268.27 g/mol, XLogP of 1.58, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-xanthene-4,5-dicarboxamide is sourced from PubChem (CID 162768624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).