C11H11F2NS — CID 84791480
3-[2-(2,2-difluoroethylsulfanyl)phenyl]propanenitrile (PubChem CID 84791480) has the molecular formula C11H11F2NS and a molecular weight of 227.28 g/mol. Its IUPAC name is 3-[2-(2,2-difluoroethylsulfanyl)phenyl]propanenitrile.
| Compound Name | 3-[2-(2,2-difluoroethylsulfanyl)phenyl]propanenitrile |
|---|---|
| PubChem CID | 84791480 |
| Molecular Formula | C11H11F2NS |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 3-[2-(2,2-difluoroethylsulfanyl)phenyl]propanenitrile |
| SMILES | N#CCCc1ccccc1SCC(F)F |
| InChI | InChI=1S/C11H11F2NS/c12-11(13)8-15-10-6-2-1-4-9(10)5-3-7-14/h1-2,4,6,11H,3,5,8H2 |
| InChIKey | CFXYGPBAUIWWRQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |