About methyl 4-(cyclopropylmethyl)-3,3-difluorothiane-4-carboxylate
methyl 4-(cyclopropylmethyl)-3,3-difluorothiane-4-carboxylate (PubChem CID 84803915) has the molecular formula C11H16F2O2S
and a molecular weight of 250.31 g/mol. Its IUPAC name is methyl 4-(cyclopropylmethyl)-3,3-difluorothiane-4-carboxylate.
Analyze methyl 4-(cyclopropylmethyl)-3,3-difluorothiane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(cyclopropylmethyl)-3,3-difluorothiane-4-carboxylate?
The IUPAC name of methyl 4-(cyclopropylmethyl)-3,3-difluorothiane-4-carboxylate (CID 84803915) is methyl 4-(cyclopropylmethyl)-3,3-difluorothiane-4-carboxylate.
What is the SMILES notation for methyl 4-(cyclopropylmethyl)-3,3-difluorothiane-4-carboxylate?
The canonical SMILES for methyl 4-(cyclopropylmethyl)-3,3-difluorothiane-4-carboxylate is COC(=O)C1(CC2CC2)CCSCC1(F)F.
What is the InChIKey of methyl 4-(cyclopropylmethyl)-3,3-difluorothiane-4-carboxylate?
The InChIKey is CBYNFYWLRXJJSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F2O2S/c1-15-9(14)10(6-8-2-3-8)4-5-16-7-11(10,12)13/h8H,2-7H2,1H3.
What are the key properties of methyl 4-(cyclopropylmethyl)-3,3-difluorothiane-4-carboxylate?
methyl 4-(cyclopropylmethyl)-3,3-difluorothiane-4-carboxylate has a molecular weight of 250.31 g/mol, XLogP of 2.72, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(cyclopropylmethyl)-3,3-difluorothiane-4-carboxylate is sourced from PubChem (CID 84803915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).