methyl 3-(cyclopropylmethyl)-4,4-difluorothiane-3-carboxylate

C11H16F2O2S — CID 84803917

IUPACmethyl 3-(cyclopropylmethyl)-4,4-difluorothiane-3-carboxylate
SMILESCOC(=O)C1(CC2CC2)CSCCC1(F)F
InChIInChI=1S/C11H16F2O2S/c1-15-9(14)10(6-8-2-3-8)7-16-5-4-11(10,12)13/h8H,2-7H2,1H3
InChIKeyGFJVFIRQMYDHEO-UHFFFAOYSA-N
MW250.31 g/mol
LogP2.72
Rot. Bonds3

About methyl 3-(cyclopropylmethyl)-4,4-difluorothiane-3-carboxylate

methyl 3-(cyclopropylmethyl)-4,4-difluorothiane-3-carboxylate (PubChem CID 84803917) has the molecular formula C11H16F2O2S and a molecular weight of 250.31 g/mol. Its IUPAC name is methyl 3-(cyclopropylmethyl)-4,4-difluorothiane-3-carboxylate.

Molecular Properties

Compound Namemethyl 3-(cyclopropylmethyl)-4,4-difluorothiane-3-carboxylate
PubChem CID84803917
Molecular FormulaC11H16F2O2S
Molecular Weight250.31 g/mol
Exact Mass250.08
IUPAC Namemethyl 3-(cyclopropylmethyl)-4,4-difluorothiane-3-carboxylate
SMILESCOC(=O)C1(CC2CC2)CSCCC1(F)F
InChIInChI=1S/C11H16F2O2S/c1-15-9(14)10(6-8-2-3-8)7-16-5-4-11(10,12)13/h8H,2-7H2,1H3
InChIKeyGFJVFIRQMYDHEO-UHFFFAOYSA-N
XLogP2.72
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.31
LogP ≤ 52.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 3-(cyclopropylmethyl)-4,4-difluorothiane-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(cyclopropylmethyl)-4,4-difluorothiane-3-carboxylate?
The IUPAC name of methyl 3-(cyclopropylmethyl)-4,4-difluorothiane-3-carboxylate (CID 84803917) is methyl 3-(cyclopropylmethyl)-4,4-difluorothiane-3-carboxylate.
What is the SMILES notation for methyl 3-(cyclopropylmethyl)-4,4-difluorothiane-3-carboxylate?
The canonical SMILES for methyl 3-(cyclopropylmethyl)-4,4-difluorothiane-3-carboxylate is COC(=O)C1(CC2CC2)CSCCC1(F)F.
What is the InChIKey of methyl 3-(cyclopropylmethyl)-4,4-difluorothiane-3-carboxylate?
The InChIKey is GFJVFIRQMYDHEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F2O2S/c1-15-9(14)10(6-8-2-3-8)7-16-5-4-11(10,12)13/h8H,2-7H2,1H3.
What are the key properties of methyl 3-(cyclopropylmethyl)-4,4-difluorothiane-3-carboxylate?
methyl 3-(cyclopropylmethyl)-4,4-difluorothiane-3-carboxylate has a molecular weight of 250.31 g/mol, XLogP of 2.72, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(cyclopropylmethyl)-4,4-difluorothiane-3-carboxylate is sourced from PubChem (CID 84803917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).