C12H16N2O2S — CID 84804280
2-[(6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-3-yl)methyl]aniline (PubChem CID 84804280) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 2-[(6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-3-yl)methyl]aniline.
| Compound Name | 2-[(6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-3-yl)methyl]aniline |
|---|---|
| PubChem CID | 84804280 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 2-[(6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-3-yl)methyl]aniline |
| SMILES | Nc1ccccc1CN1CC2CC(C1)S2(=O)=O |
| InChI | InChI=1S/C12H16N2O2S/c13-12-4-2-1-3-9(12)6-14-7-10-5-11(8-14)17(10,15)16/h1-4,10-11H,5-8,13H2 |
| InChIKey | ZEYJBOTYJGKQJP-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|